C17H25NO — CID 732127
(E)-N,N-bis(2-methylpropyl)-3-phenylprop-2-enamide (PubChem CID 732127) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (E)-N,N-bis(2-methylpropyl)-3-phenylprop-2-enamide.
| Compound Name | (E)-N,N-bis(2-methylpropyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 732127 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (E)-N,N-bis(2-methylpropyl)-3-phenylprop-2-enamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H25NO/c1-14(2)12-18(13-15(3)4)17(19)11-10-16-8-6-5-7-9-16/h5-11,14-15H,12-13H2,1-4H3/b11-10+ |
| InChIKey | KDAFGAHTMUPFDX-ZHACJKMWSA-N |
| XLogP | 3.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|