C17H23Cl2NO — CID 6026974
(E)-3-(2,6-dichlorophenyl)-N,N-bis(2-methylpropyl)prop-2-enamide (PubChem CID 6026974) has the molecular formula C17H23Cl2NO and a molecular weight of 328.28 g/mol. Its IUPAC name is (E)-3-(2,6-dichlorophenyl)-N,N-bis(2-methylpropyl)prop-2-enamide.
| Compound Name | (E)-3-(2,6-dichlorophenyl)-N,N-bis(2-methylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 6026974 |
| Molecular Formula | C17H23Cl2NO |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (E)-3-(2,6-dichlorophenyl)-N,N-bis(2-methylpropyl)prop-2-enamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)/C=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H23Cl2NO/c1-12(2)10-20(11-13(3)4)17(21)9-8-14-15(18)6-5-7-16(14)19/h5-9,12-13H,10-11H2,1-4H3/b9-8+ |
| InChIKey | SMDXZQNVZFXQDS-CMDGGOBGSA-N |
| XLogP | 5.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|