C20H31NO — CID 6140170
(E)-N,N-bis(2-methylpropyl)-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 6140170) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is (E)-N,N-bis(2-methylpropyl)-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N,N-bis(2-methylpropyl)-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6140170 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | (E)-N,N-bis(2-methylpropyl)-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)/C=C/c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C20H31NO/c1-15(2)13-21(14-16(3)4)20(22)12-9-18-7-10-19(11-8-18)17(5)6/h7-12,15-17H,13-14H2,1-6H3/b12-9+ |
| InChIKey | NXWYTUZSWVYNOI-FMIVXFBMSA-N |
| XLogP | 4.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|