C13H13ClF3NO2 — CID 107482944
(E)-3-(2-chloro-6-fluorophenyl)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)prop-2-enamide (PubChem CID 107482944) has the molecular formula C13H13ClF3NO2 and a molecular weight of 307.70 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 107482944 |
| Molecular Formula | C13H13ClF3NO2 |
| Molecular Weight | 307.70 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1c(F)cccc1Cl)N(CCO)CC(F)F |
| InChI | InChI=1S/C13H13ClF3NO2/c14-10-2-1-3-11(15)9(10)4-5-13(20)18(6-7-19)8-12(16)17/h1-5,12,19H,6-8H2/b5-4+ |
| InChIKey | TYRIEBRSCNBMDI-SNAWJCMRSA-N |
| XLogP | 2.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.70 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|