C12H15F2NO2S — CID 107483217
(E)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-3-(5-methylthiophen-2-yl)prop-2-enamide (PubChem CID 107483217) has the molecular formula C12H15F2NO2S and a molecular weight of 275.32 g/mol. Its IUPAC name is (E)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-3-(5-methylthiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-3-(5-methylthiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 107483217 |
| Molecular Formula | C12H15F2NO2S |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (E)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-3-(5-methylthiophen-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)N(CCO)CC(F)F)s1 |
| InChI | InChI=1S/C12H15F2NO2S/c1-9-2-3-10(18-9)4-5-12(17)15(6-7-16)8-11(13)14/h2-5,11,16H,6-8H2,1H3/b5-4+ |
| InChIKey | IWSVECVBSMDBFP-SNAWJCMRSA-N |
| XLogP | 2.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|