C11H11BrF3NO2S — CID 103857353
(E)-3-(5-bromothiophen-2-yl)-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 103857353) has the molecular formula C11H11BrF3NO2S and a molecular weight of 358.18 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 103857353 |
| Molecular Formula | C11H11BrF3NO2S |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Br)s1)N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C11H11BrF3NO2S/c12-9-3-1-8(19-9)2-4-10(18)16(5-6-17)7-11(13,14)15/h1-4,17H,5-7H2/b4-2+ |
| InChIKey | PFHRBZPVOHXPOD-DUXPYHPUSA-N |
| XLogP | 2.91 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|