C13H14BrF2NO2 — CID 107483019
(E)-3-(4-bromophenyl)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)prop-2-enamide (PubChem CID 107483019) has the molecular formula C13H14BrF2NO2 and a molecular weight of 334.16 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)prop-2-enamide.
| Compound Name | (E)-3-(4-bromophenyl)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 107483019 |
| Molecular Formula | C13H14BrF2NO2 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | (E)-3-(4-bromophenyl)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Br)cc1)N(CCO)CC(F)F |
| InChI | InChI=1S/C13H14BrF2NO2/c14-11-4-1-10(2-5-11)3-6-13(19)17(7-8-18)9-12(15)16/h1-6,12,18H,7-9H2/b6-3+ |
| InChIKey | HNQSVPRZQQVCHP-ZZXKWVIFSA-N |
| XLogP | 2.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|