C15H21NO3 — CID 176654258
N,N-bis(3-hydroxypropyl)-3-phenylprop-2-enamide (PubChem CID 176654258) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is N,N-bis(3-hydroxypropyl)-3-phenylprop-2-enamide.
| Compound Name | N,N-bis(3-hydroxypropyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 176654258 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N,N-bis(3-hydroxypropyl)-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)N(CCCO)CCCO |
| InChI | InChI=1S/C15H21NO3/c17-12-4-10-16(11-5-13-18)15(19)9-8-14-6-2-1-3-7-14/h1-3,6-9,17-18H,4-5,10-13H2 |
| InChIKey | YPPXLOSCOICAAT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|