C14H17NO4 — CID 57194236
N,N-bis(2-hydroxyethyl)-2-oxo-4-phenylbut-3-enamide (PubChem CID 57194236) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-2-oxo-4-phenylbut-3-enamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-2-oxo-4-phenylbut-3-enamide |
|---|---|
| PubChem CID | 57194236 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-2-oxo-4-phenylbut-3-enamide |
| SMILES | O=C(C=Cc1ccccc1)C(=O)N(CCO)CCO |
| InChI | InChI=1S/C14H17NO4/c16-10-8-15(9-11-17)14(19)13(18)7-6-12-4-2-1-3-5-12/h1-7,16-17H,8-11H2 |
| InChIKey | QGRFLJSQEAYEAM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|