C16H21NO2 — CID 11470935
(E)-2-oxo-4-phenyl-N,N-di(propan-2-yl)but-3-enamide (PubChem CID 11470935) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (E)-2-oxo-4-phenyl-N,N-di(propan-2-yl)but-3-enamide.
| Compound Name | (E)-2-oxo-4-phenyl-N,N-di(propan-2-yl)but-3-enamide |
|---|---|
| PubChem CID | 11470935 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (E)-2-oxo-4-phenyl-N,N-di(propan-2-yl)but-3-enamide |
| SMILES | CC(C)N(C(=O)C(=O)/C=C/c1ccccc1)C(C)C |
| InChI | InChI=1S/C16H21NO2/c1-12(2)17(13(3)4)16(19)15(18)11-10-14-8-6-5-7-9-14/h5-13H,1-4H3/b11-10+ |
| InChIKey | QEJXREWMRANWQW-ZHACJKMWSA-N |
| XLogP | 2.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|