C14H17NO — CID 44725715
(1Z,4E)-1-(dimethylamino)-2-methyl-5-phenylpenta-1,4-dien-3-one (PubChem CID 44725715) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is (1Z,4E)-1-(dimethylamino)-2-methyl-5-phenylpenta-1,4-dien-3-one.
| Compound Name | (1Z,4E)-1-(dimethylamino)-2-methyl-5-phenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 44725715 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (1Z,4E)-1-(dimethylamino)-2-methyl-5-phenylpenta-1,4-dien-3-one |
| SMILES | C/C(=C/N(C)C)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H17NO/c1-12(11-15(2)3)14(16)10-9-13-7-5-4-6-8-13/h4-11H,1-3H3/b10-9+,12-11- |
| InChIKey | PCHDJRQCFNATCA-PVHUKWJHSA-N |
| XLogP | 2.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|