C13H13ClO — CID 15046066
(1E,4Z)-4-chloro-1-phenylhepta-1,4-dien-3-one (PubChem CID 15046066) has the molecular formula C13H13ClO and a molecular weight of 220.70 g/mol. Its IUPAC name is (1E,4Z)-4-chloro-1-phenylhepta-1,4-dien-3-one.
| Compound Name | (1E,4Z)-4-chloro-1-phenylhepta-1,4-dien-3-one |
|---|---|
| PubChem CID | 15046066 |
| Molecular Formula | C13H13ClO |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (1E,4Z)-4-chloro-1-phenylhepta-1,4-dien-3-one |
| SMILES | CC/C=C(\Cl)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C13H13ClO/c1-2-6-12(14)13(15)10-9-11-7-4-3-5-8-11/h3-10H,2H2,1H3/b10-9+,12-6- |
| InChIKey | FTILIPWLQKIQBB-HAOYQXNBSA-N |
| XLogP | 3.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|