C18H19NO2S — CID 6367762
(1E,3E)-2-(benzenesulfonyl)-N,N-dimethyl-4-phenylbuta-1,3-dien-1-amine (PubChem CID 6367762) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is (1E,3E)-2-(benzenesulfonyl)-N,N-dimethyl-4-phenylbuta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-2-(benzenesulfonyl)-N,N-dimethyl-4-phenylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 6367762 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (1E,3E)-2-(benzenesulfonyl)-N,N-dimethyl-4-phenylbuta-1,3-dien-1-amine |
| SMILES | CN(C)/C=C(\C=C\c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19NO2S/c1-19(2)15-18(14-13-16-9-5-3-6-10-16)22(20,21)17-11-7-4-8-12-17/h3-15H,1-2H3/b14-13+,18-15+ |
| InChIKey | YWXQCGCSSZBVKU-UUVOMYAKSA-N |
| XLogP | 3.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|