C14H18O2S — CID 143136700
[(2E,4Z)-6-methylhepta-2,4-dien-3-yl]sulfonylbenzene (PubChem CID 143136700) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is [(2E,4Z)-6-methylhepta-2,4-dien-3-yl]sulfonylbenzene.
| Compound Name | [(2E,4Z)-6-methylhepta-2,4-dien-3-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 143136700 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | [(2E,4Z)-6-methylhepta-2,4-dien-3-yl]sulfonylbenzene |
| SMILES | C/C=C(\C=C/C(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18O2S/c1-4-13(11-10-12(2)3)17(15,16)14-8-6-5-7-9-14/h4-12H,1-3H3/b11-10-,13-4+ |
| InChIKey | DDGSFGLDAWGEJP-GRDXPDJJSA-N |
| XLogP | 3.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|