C19H22S — CID 123739336
hexa-2,4-dien-3-yl-methyl-diphenyl-λ4-sulfane (PubChem CID 123739336) has the molecular formula C19H22S and a molecular weight of 282.45 g/mol. Its IUPAC name is hexa-2,4-dien-3-yl-methyl-diphenyl-λ4-sulfane.
| Compound Name | hexa-2,4-dien-3-yl-methyl-diphenyl-λ4-sulfane |
|---|---|
| PubChem CID | 123739336 |
| Molecular Formula | C19H22S |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | hexa-2,4-dien-3-yl-methyl-diphenyl-λ4-sulfane |
| SMILES | CC=CC(=CC)S(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22S/c1-4-12-17(5-2)20(3,18-13-8-6-9-14-18)19-15-10-7-11-16-19/h4-16H,1-3H3 |
| InChIKey | MWHQMVGQICZWOV-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|