C15H24 — CID 142853648
ethane;[(3Z)-penta-1,3-dien-2-yl]benzene (PubChem CID 142853648) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is ethane;[(3Z)-penta-1,3-dien-2-yl]benzene.
| Compound Name | ethane;[(3Z)-penta-1,3-dien-2-yl]benzene |
|---|---|
| PubChem CID | 142853648 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | ethane;[(3Z)-penta-1,3-dien-2-yl]benzene |
| SMILES | C=C(/C=C\C)c1ccccc1.CC.CC |
| InChI | InChI=1S/C11H12.2C2H6/c1-3-7-10(2)11-8-5-4-6-9-11;2*1-2/h3-9H,2H2,1H3;2*1-2H3/b7-3-;; |
| InChIKey | ZWWHEYJFAHEMOF-NAMRTZQUSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|