C12H14NO+ — CID 143963198
methoxy-methylidene-[(1Z)-3-phenylbuta-1,3-dienyl]azanium (PubChem CID 143963198) has the molecular formula C12H14NO+ and a molecular weight of 188.25 g/mol. Its IUPAC name is methoxy-methylidene-[(1Z)-3-phenylbuta-1,3-dienyl]azanium.
| Compound Name | methoxy-methylidene-[(1Z)-3-phenylbuta-1,3-dienyl]azanium |
|---|---|
| PubChem CID | 143963198 |
| Molecular Formula | C12H14NO+ |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | methoxy-methylidene-[(1Z)-3-phenylbuta-1,3-dienyl]azanium |
| SMILES | C=C(/C=C\[N+](=C)OC)c1ccccc1 |
| InChI | InChI=1S/C12H14NO/c1-11(9-10-13(2)14-3)12-7-5-4-6-8-12/h4-10H,1-2H2,3H3/q+1/b10-9- |
| InChIKey | ZMAJAWPLMPPXFU-KTKRTIGZSA-N |
| XLogP | 2.49 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|