C12H12O — CID 173058434
(1E,3E)-5-phenylhexa-1,3,5-trien-1-ol (PubChem CID 173058434) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is (1E,3E)-5-phenylhexa-1,3,5-trien-1-ol.
| Compound Name | (1E,3E)-5-phenylhexa-1,3,5-trien-1-ol |
|---|---|
| PubChem CID | 173058434 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | (1E,3E)-5-phenylhexa-1,3,5-trien-1-ol |
| SMILES | C=C(/C=C/C=C/O)c1ccccc1 |
| InChI | InChI=1S/C12H12O/c1-11(7-5-6-10-13)12-8-3-2-4-9-12/h2-10,13H,1H2/b7-5+,10-6+ |
| InChIKey | ZNZDCSGJUYOIJH-YLNKAEQOSA-N |
| XLogP | 3.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|