C14H10S2-2 — CID 102075609
(E)-1,2-diphenylethene-1,2-dithiolate (PubChem CID 102075609) has the molecular formula C14H10S2-2 and a molecular weight of 242.37 g/mol. Its IUPAC name is (E)-1,2-diphenylethene-1,2-dithiolate.
| Compound Name | (E)-1,2-diphenylethene-1,2-dithiolate |
|---|---|
| PubChem CID | 102075609 |
| Molecular Formula | C14H10S2-2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | (E)-1,2-diphenylethene-1,2-dithiolate |
| SMILES | [S-]/C(=C(/[S-])c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12S2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,15-16H/p-2/b14-13+ |
| InChIKey | HNQWTAFLMHBOSS-BUHFOSPRSA-L |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|