About sodium;benzenecarbodithioate;hydrate
sodium;benzenecarbodithioate;hydrate (PubChem CID 141096232) has the molecular formula C7H7NaOS2
and a molecular weight of 194.26 g/mol. Its IUPAC name is sodium;benzenecarbodithioate;hydrate.
Molecular Properties
| Compound Name | sodium;benzenecarbodithioate;hydrate |
| PubChem CID | 141096232 |
| Molecular Formula | C7H7NaOS2 |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 193.98 |
| IUPAC Name | sodium;benzenecarbodithioate;hydrate |
| SMILES | O.S=C([S-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C7H6S2.Na.H2O/c8-7(9)6-4-2-1-3-5-6;;/h1-5H,(H,8,9);;1H2/q;+1;/p-1 |
| InChIKey | YORKKVJSRPDIFH-UHFFFAOYSA-M |
| XLogP | -1.91 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;benzenecarbodithioate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzenecarbodithioate;hydrate?
The IUPAC name of sodium;benzenecarbodithioate;hydrate (CID 141096232) is sodium;benzenecarbodithioate;hydrate.
What is the SMILES notation for sodium;benzenecarbodithioate;hydrate?
The canonical SMILES for sodium;benzenecarbodithioate;hydrate is O.S=C([S-])c1ccccc1.[Na+].
What is the InChIKey of sodium;benzenecarbodithioate;hydrate?
The InChIKey is YORKKVJSRPDIFH-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6S2.Na.H2O/c8-7(9)6-4-2-1-3-5-6;;/h1-5H,(H,8,9);;1H2/q;+1;/p-1.
What are the key properties of sodium;benzenecarbodithioate;hydrate?
sodium;benzenecarbodithioate;hydrate has a molecular weight of 194.26 g/mol, XLogP of -1.91, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzenecarbodithioate;hydrate is sourced from PubChem (CID 141096232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).