About O-sulfanyl benzenecarbothioate
O-sulfanyl benzenecarbothioate (PubChem CID 141463244) has the molecular formula C7H6OS2
and a molecular weight of 170.26 g/mol. Its IUPAC name is O-sulfanyl benzenecarbothioate.
Molecular Properties
| Compound Name | O-sulfanyl benzenecarbothioate |
| PubChem CID | 141463244 |
| Molecular Formula | C7H6OS2 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 169.99 |
| IUPAC Name | O-sulfanyl benzenecarbothioate |
| SMILES | S=C(OS)c1ccccc1 |
| InChI | InChI=1S/C7H6OS2/c9-7(8-10)6-4-2-1-3-5-6/h1-5,10H |
| InChIKey | QEPLAXIDQNNSPH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze O-sulfanyl benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-sulfanyl benzenecarbothioate?
The IUPAC name of O-sulfanyl benzenecarbothioate (CID 141463244) is O-sulfanyl benzenecarbothioate.
What is the SMILES notation for O-sulfanyl benzenecarbothioate?
The canonical SMILES for O-sulfanyl benzenecarbothioate is S=C(OS)c1ccccc1.
What is the InChIKey of O-sulfanyl benzenecarbothioate?
The InChIKey is QEPLAXIDQNNSPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6OS2/c9-7(8-10)6-4-2-1-3-5-6/h1-5,10H.
What are the key properties of O-sulfanyl benzenecarbothioate?
O-sulfanyl benzenecarbothioate has a molecular weight of 170.26 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-sulfanyl benzenecarbothioate is sourced from PubChem (CID 141463244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).