About CID 12505640
CID 12505640 (PubChem CID 12505640) has the molecular formula C13H11O
and a molecular weight of 183.23 g/mol.
Molecular Properties
| Compound Name | CID 12505640 |
| PubChem CID | 12505640 |
| Molecular Formula | C13H11O |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | — |
| SMILES | O[C](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H11O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H |
| InChIKey | LXWWZECRYAXGID-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 12505640 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12505640?
The IUPAC name of CID 12505640 (CID 12505640) is not available.
What is the SMILES notation for CID 12505640?
The canonical SMILES for CID 12505640 is O[C](c1ccccc1)c1ccccc1.
What is the InChIKey of CID 12505640?
The InChIKey is LXWWZECRYAXGID-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H.
What are the key properties of CID 12505640?
CID 12505640 has a molecular weight of 183.23 g/mol, XLogP of 2.99, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12505640 is sourced from PubChem (CID 12505640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).