About CID 11173820
CID 11173820 (PubChem CID 11173820) has the molecular formula C17H15FeO+2
and a molecular weight of 291.15 g/mol.
Molecular Properties
| Compound Name | CID 11173820 |
| PubChem CID | 11173820 |
| Molecular Formula | C17H15FeO+2 |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | — |
| SMILES | O[C]([C]1[CH][CH][CH][CH]1)c1ccccc1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C12H10O.C5H5.Fe/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10;1-2-4-5-3-1;/h1-9,13H;1-5H;/q;;+2 |
| InChIKey | NKHFAHZTAQEJHY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 11173820 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11173820?
The IUPAC name of CID 11173820 (CID 11173820) is not available.
What is the SMILES notation for CID 11173820?
The canonical SMILES for CID 11173820 is O[C]([C]1[CH][CH][CH][CH]1)c1ccccc1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 11173820?
The InChIKey is NKHFAHZTAQEJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C5H5.Fe/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10;1-2-4-5-3-1;/h1-9,13H;1-5H;/q;;+2.
What are the key properties of CID 11173820?
CID 11173820 has a molecular weight of 291.15 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11173820 is sourced from PubChem (CID 11173820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).