About phenacyl
phenacyl (PubChem CID 11123355) has the molecular formula C8H7O
and a molecular weight of 119.14 g/mol.
Molecular Properties
| Compound Name | phenacyl |
| PubChem CID | 11123355 |
| Molecular Formula | C8H7O |
| Molecular Weight | 119.14 g/mol |
| Exact Mass | 119.05 |
| IUPAC Name | — |
| SMILES | C=C([O])c1ccccc1 |
| InChI | InChI=1S/C8H7O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2 |
| InChIKey | XAKBSHICSHRJCL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 19.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.14 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze phenacyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacyl?
The IUPAC name of phenacyl (CID 11123355) is not available.
What is the SMILES notation for phenacyl?
The canonical SMILES for phenacyl is C=C([O])c1ccccc1.
What is the InChIKey of phenacyl?
The InChIKey is XAKBSHICSHRJCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2.
What are the key properties of phenacyl?
phenacyl has a molecular weight of 119.14 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl is sourced from PubChem (CID 11123355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).