C14H16 — CID 159301078
buta-1,3-diene;buta-1,3-dien-2-ylbenzene (PubChem CID 159301078) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is buta-1,3-diene;buta-1,3-dien-2-ylbenzene.
| Compound Name | buta-1,3-diene;buta-1,3-dien-2-ylbenzene |
|---|---|
| PubChem CID | 159301078 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | buta-1,3-diene;buta-1,3-dien-2-ylbenzene |
| SMILES | C=CC(=C)c1ccccc1.C=CC=C |
| InChI | InChI=1S/C10H10.C4H6/c1-3-9(2)10-7-5-4-6-8-10;1-3-4-2/h3-8H,1-2H2;3-4H,1-2H2 |
| InChIKey | LBIOHQBDNNJWGQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|