C16H14Sm — CID 173396801
1-phenylbuta-1,3-dienylbenzene;samarium (PubChem CID 173396801) has the molecular formula C16H14Sm and a molecular weight of 356.65 g/mol. Its IUPAC name is 1-phenylbuta-1,3-dienylbenzene;samarium.
| Compound Name | 1-phenylbuta-1,3-dienylbenzene;samarium |
|---|---|
| PubChem CID | 173396801 |
| Molecular Formula | C16H14Sm |
| Molecular Weight | 356.65 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 1-phenylbuta-1,3-dienylbenzene;samarium |
| SMILES | C=CC=C(c1ccccc1)c1ccccc1.[Sm] |
| InChI | InChI=1S/C16H14.Sm/c1-2-9-16(14-10-5-3-6-11-14)15-12-7-4-8-13-15;/h2-13H,1H2; |
| InChIKey | CYHPLRSVFRYTSC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.65 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|