C21H22O2 — CID 158549919
1-phenylhexa-1,3,5-trienylbenzene;propanoic acid (PubChem CID 158549919) has the molecular formula C21H22O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-phenylhexa-1,3,5-trienylbenzene;propanoic acid.
| Compound Name | 1-phenylhexa-1,3,5-trienylbenzene;propanoic acid |
|---|---|
| PubChem CID | 158549919 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-phenylhexa-1,3,5-trienylbenzene;propanoic acid |
| SMILES | C=CC=CC=C(c1ccccc1)c1ccccc1.CCC(=O)O |
| InChI | InChI=1S/C18H16.C3H6O2/c1-2-3-6-15-18(16-11-7-4-8-12-16)17-13-9-5-10-14-17;1-2-3(4)5/h2-15H,1H2;2H2,1H3,(H,4,5) |
| InChIKey | HPOYQLNLQKPZHO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|