C22H22O2 — CID 146535524
(2E,4E,6E,8Z)-2,6-dimethyl-1-phenyl-4-prop-2-enylideneundeca-2,6,8,10-tetraene-1,5-dione (PubChem CID 146535524) has the molecular formula C22H22O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is (2E,4E,6E,8Z)-2,6-dimethyl-1-phenyl-4-prop-2-enylideneundeca-2,6,8,10-tetraene-1,5-dione.
| Compound Name | (2E,4E,6E,8Z)-2,6-dimethyl-1-phenyl-4-prop-2-enylideneundeca-2,6,8,10-tetraene-1,5-dione |
|---|---|
| PubChem CID | 146535524 |
| Molecular Formula | C22H22O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (2E,4E,6E,8Z)-2,6-dimethyl-1-phenyl-4-prop-2-enylideneundeca-2,6,8,10-tetraene-1,5-dione |
| SMILES | C=C/C=C\C=C(/C)C(=O)C(/C=C(\C)C(=O)c1ccccc1)=C/C=C |
| InChI | InChI=1S/C22H22O2/c1-5-7-9-13-17(3)21(23)20(12-6-2)16-18(4)22(24)19-14-10-8-11-15-19/h5-16H,1-2H2,3-4H3/b9-7-,17-13+,18-16+,20-12+ |
| InChIKey | OJTDEOAFNVUMNX-AUNQYSAOSA-N |
| XLogP | 5.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|