C19H20 — CID 145134846
[(3E,5E,7E)-7-ethenyl-6-methyldeca-1,3,5,7,9-pentaen-4-yl]benzene (PubChem CID 145134846) has the molecular formula C19H20 and a molecular weight of 248.37 g/mol. Its IUPAC name is [(3E,5E,7E)-7-ethenyl-6-methyldeca-1,3,5,7,9-pentaen-4-yl]benzene.
| Compound Name | [(3E,5E,7E)-7-ethenyl-6-methyldeca-1,3,5,7,9-pentaen-4-yl]benzene |
|---|---|
| PubChem CID | 145134846 |
| Molecular Formula | C19H20 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | [(3E,5E,7E)-7-ethenyl-6-methyldeca-1,3,5,7,9-pentaen-4-yl]benzene |
| SMILES | C=C/C=C(C=C)/C(C)=C/C(=C\C=C)c1ccccc1 |
| InChI | InChI=1S/C19H20/c1-5-11-17(7-3)16(4)15-19(12-6-2)18-13-9-8-10-14-18/h5-15H,1-3H2,4H3/b16-15+,17-11+,19-12+ |
| InChIKey | DPWCRPLNIVIAPD-MERXXMOLSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|