C27H26 — CID 142373254
[(3E)-3-ethenyl-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-phenylhexa-1,3,5-trienyl]benzene (PubChem CID 142373254) has the molecular formula C27H26 and a molecular weight of 350.51 g/mol. Its IUPAC name is [(3E)-3-ethenyl-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-phenylhexa-1,3,5-trienyl]benzene.
| Compound Name | [(3E)-3-ethenyl-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-phenylhexa-1,3,5-trienyl]benzene |
|---|---|
| PubChem CID | 142373254 |
| Molecular Formula | C27H26 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | [(3E)-3-ethenyl-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-phenylhexa-1,3,5-trienyl]benzene |
| SMILES | C=C/C=C(/C=C\C)C(=C(c1ccccc1)c1ccccc1)/C(C=C)=C/C=C |
| InChI | InChI=1S/C27H26/c1-5-15-22(8-4)26(23(16-6-2)17-7-3)27(24-18-11-9-12-19-24)25-20-13-10-14-21-25/h5-21H,1-2,4H2,3H3/b17-7-,22-15+,23-16+ |
| InChIKey | BDWASXNZGOBCBE-IVFKNSKOSA-N |
| XLogP | 7.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|