C18H28O — CID 142285678
ethane;(3E,6E)-4-ethenyl-6-[(Z)-prop-1-enyl]nona-1,3,6,8-tetraen-5-one (PubChem CID 142285678) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is ethane;(3E,6E)-4-ethenyl-6-[(Z)-prop-1-enyl]nona-1,3,6,8-tetraen-5-one.
| Compound Name | ethane;(3E,6E)-4-ethenyl-6-[(Z)-prop-1-enyl]nona-1,3,6,8-tetraen-5-one |
|---|---|
| PubChem CID | 142285678 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | ethane;(3E,6E)-4-ethenyl-6-[(Z)-prop-1-enyl]nona-1,3,6,8-tetraen-5-one |
| SMILES | C=C/C=C(\C=C)C(=O)C(/C=C\C)=C/C=C.CC.CC |
| InChI | InChI=1S/C14H16O.2C2H6/c1-5-9-12(8-4)14(15)13(10-6-2)11-7-3;2*1-2/h5-11H,1-2,4H2,3H3;2*1-2H3/b11-7-,12-9+,13-10+;; |
| InChIKey | HZRKWOGNIAWYHR-MYXXEYRISA-N |
| XLogP | 5.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|