C22H38O — CID 144664030
ethane;(3E,6E)-6-ethenyl-9-methyl-4-[(Z)-prop-1-enyl]deca-1,3,6,8-tetraen-5-one (PubChem CID 144664030) has the molecular formula C22H38O and a molecular weight of 318.55 g/mol. Its IUPAC name is ethane;(3E,6E)-6-ethenyl-9-methyl-4-[(Z)-prop-1-enyl]deca-1,3,6,8-tetraen-5-one.
| Compound Name | ethane;(3E,6E)-6-ethenyl-9-methyl-4-[(Z)-prop-1-enyl]deca-1,3,6,8-tetraen-5-one |
|---|---|
| PubChem CID | 144664030 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | ethane;(3E,6E)-6-ethenyl-9-methyl-4-[(Z)-prop-1-enyl]deca-1,3,6,8-tetraen-5-one |
| SMILES | C=C/C=C(\C=C/C)C(=O)/C(C=C)=C/C=C(C)C.CC.CC.CC |
| InChI | InChI=1S/C16H20O.3C2H6/c1-6-9-15(10-7-2)16(17)14(8-3)12-11-13(4)5;3*1-2/h6-12H,1,3H2,2,4-5H3;3*1-2H3/b10-7-,14-12+,15-9+;;; |
| InChIKey | DSYQCXNXMYISHO-ZWYXWQAISA-N |
| XLogP | 7.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|