C12H16 — CID 123583886
4-ethenyl-5-ethylideneocta-1,3,6-triene (PubChem CID 123583886) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is 4-ethenyl-5-ethylideneocta-1,3,6-triene.
| Compound Name | 4-ethenyl-5-ethylideneocta-1,3,6-triene |
|---|---|
| PubChem CID | 123583886 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 4-ethenyl-5-ethylideneocta-1,3,6-triene |
| SMILES | C=CC=C(C=C)C(C=CC)=CC |
| InChI | InChI=1S/C12H16/c1-5-9-11(7-3)12(8-4)10-6-2/h5-10H,1,3H2,2,4H3 |
| InChIKey | ACXJXSKHPFGRMD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|