C13H20 — CID 142141594
(3Z,4Z,6Z)-4-ethenyl-3-ethylideneocta-1,4,6-triene;methane (PubChem CID 142141594) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is (3Z,4Z,6Z)-4-ethenyl-3-ethylideneocta-1,4,6-triene;methane.
| Compound Name | (3Z,4Z,6Z)-4-ethenyl-3-ethylideneocta-1,4,6-triene;methane |
|---|---|
| PubChem CID | 142141594 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (3Z,4Z,6Z)-4-ethenyl-3-ethylideneocta-1,4,6-triene;methane |
| SMILES | C.C=CC(=C/C=C\C)/C(C=C)=C\C |
| InChI | InChI=1S/C12H16.CH4/c1-5-9-10-12(8-4)11(6-2)7-3;/h5-10H,2,4H2,1,3H3;1H4/b9-5-,11-7-,12-10-; |
| InChIKey | VIUKKSFMVGBYKG-CJTXUHCASA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|