C9H10F2O — CID 145079056
(3E,5Z)-3-ethenyl-1,1-difluorohepta-3,5-dien-2-one (PubChem CID 145079056) has the molecular formula C9H10F2O and a molecular weight of 172.17 g/mol. Its IUPAC name is (3E,5Z)-3-ethenyl-1,1-difluorohepta-3,5-dien-2-one.
| Compound Name | (3E,5Z)-3-ethenyl-1,1-difluorohepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 145079056 |
| Molecular Formula | C9H10F2O |
| Molecular Weight | 172.17 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (3E,5Z)-3-ethenyl-1,1-difluorohepta-3,5-dien-2-one |
| SMILES | C=C/C(=C\C=C/C)C(=O)C(F)F |
| InChI | InChI=1S/C9H10F2O/c1-3-5-6-7(4-2)8(12)9(10)11/h3-6,9H,2H2,1H3/b5-3-,7-6+ |
| InChIKey | CVGJGMOBMWHVOJ-AIJKMKQJSA-N |
| XLogP | 2.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.17 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|