About (4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine
(4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine (PubChem CID 143337723) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is (4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine.
Molecular Properties
| Compound Name | (4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine |
| PubChem CID | 143337723 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine |
| SMILES | C=C/C(=C\C=C/C)C(=O)CC.CNC |
| InChI | InChI=1S/C10H14O.C2H7N/c1-4-7-8-9(5-2)10(11)6-3;1-3-2/h4-5,7-8H,2,6H2,1,3H3;3H,1-2H3/b7-4-,9-8+; |
| InChIKey | VSHXDUJZLJFAPG-HJOQNNTHSA-N |
| XLogP | 2.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine?
The IUPAC name of (4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine (CID 143337723) is (4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine.
What is the SMILES notation for (4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine?
The canonical SMILES for (4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine is C=C/C(=C\C=C/C)C(=O)CC.CNC.
What is the InChIKey of (4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine?
The InChIKey is VSHXDUJZLJFAPG-HJOQNNTHSA-N. The full InChI is InChI=1S/C10H14O.C2H7N/c1-4-7-8-9(5-2)10(11)6-3;1-3-2/h4-5,7-8H,2,6H2,1,3H3;3H,1-2H3/b7-4-,9-8+;.
What are the key properties of (4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine?
(4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine has a molecular weight of 195.31 g/mol, XLogP of 2.49, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine is sourced from PubChem (CID 143337723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).