C12H21NO — CID 143337723
(4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine (PubChem CID 143337723) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine.
| Compound Name | (4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine |
|---|---|
| PubChem CID | 143337723 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (4E,6Z)-4-ethenylocta-4,6-dien-3-one;N-methylmethanamine |
| SMILES | C=C/C(=C\C=C/C)C(=O)CC.CNC |
| InChI | InChI=1S/C10H14O.C2H7N/c1-4-7-8-9(5-2)10(11)6-3;1-3-2/h4-5,7-8H,2,6H2,1,3H3;3H,1-2H3/b7-4-,9-8+; |
| InChIKey | VSHXDUJZLJFAPG-HJOQNNTHSA-N |
| XLogP | 2.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|