C16H18O4 — CID 130242351
[(3Z)-5-methoxycarbonylhexa-1,3,5-trien-2-yl] (2E,4E)-2-ethenylhexa-2,4-dienoate (PubChem CID 130242351) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is [(3Z)-5-methoxycarbonylhexa-1,3,5-trien-2-yl] (2E,4E)-2-ethenylhexa-2,4-dienoate.
| Compound Name | [(3Z)-5-methoxycarbonylhexa-1,3,5-trien-2-yl] (2E,4E)-2-ethenylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 130242351 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | [(3Z)-5-methoxycarbonylhexa-1,3,5-trien-2-yl] (2E,4E)-2-ethenylhexa-2,4-dienoate |
| SMILES | C=C/C(=C\C=C\C)C(=O)OC(=C)/C=C\C(=C)C(=O)OC |
| InChI | InChI=1S/C16H18O4/c1-6-8-9-14(7-2)16(18)20-13(4)11-10-12(3)15(17)19-5/h6-11H,2-4H2,1,5H3/b8-6+,11-10-,14-9+ |
| InChIKey | MRHZQBRORRSIHS-PXZUIANHSA-N |
| XLogP | 3.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|