C16H20 — CID 144553948
(3Z,7E,9Z)-7-ethenyl-2-methyl-5,6-dimethylideneundeca-1,3,7,9-tetraene (PubChem CID 144553948) has the molecular formula C16H20 and a molecular weight of 212.34 g/mol. Its IUPAC name is (3Z,7E,9Z)-7-ethenyl-2-methyl-5,6-dimethylideneundeca-1,3,7,9-tetraene.
| Compound Name | (3Z,7E,9Z)-7-ethenyl-2-methyl-5,6-dimethylideneundeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 144553948 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | (3Z,7E,9Z)-7-ethenyl-2-methyl-5,6-dimethylideneundeca-1,3,7,9-tetraene |
| SMILES | C=C/C(=C\C=C/C)C(=C)C(=C)/C=C\C(=C)C |
| InChI | InChI=1S/C16H20/c1-7-9-10-16(8-2)15(6)14(5)12-11-13(3)4/h7-12H,2-3,5-6H2,1,4H3/b9-7-,12-11-,16-10+ |
| InChIKey | OMBCPAYRSAILIK-ZFERBUDISA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|