C18H26 — CID 144604694
3-ethenyl-6-methylhepta-1,3,5-triene;(3Z,5Z)-2-methylhepta-1,3,5-triene (PubChem CID 144604694) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 3-ethenyl-6-methylhepta-1,3,5-triene;(3Z,5Z)-2-methylhepta-1,3,5-triene.
| Compound Name | 3-ethenyl-6-methylhepta-1,3,5-triene;(3Z,5Z)-2-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 144604694 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 3-ethenyl-6-methylhepta-1,3,5-triene;(3Z,5Z)-2-methylhepta-1,3,5-triene |
| SMILES | C=C(C)/C=C\C=C/C.C=CC(C=C)=CC=C(C)C |
| InChI | InChI=1S/C10H14.C8H12/c1-5-10(6-2)8-7-9(3)4;1-4-5-6-7-8(2)3/h5-8H,1-2H2,3-4H3;4-7H,2H2,1,3H3/b;5-4-,7-6- |
| InChIKey | NZAJPHCTVWFBOA-ZBRBURFXSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|