C15H20 — CID 72567686
2-methyltetradeca-2,4,6,8,10,12-hexaene (PubChem CID 72567686) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 2-methyltetradeca-2,4,6,8,10,12-hexaene.
| Compound Name | 2-methyltetradeca-2,4,6,8,10,12-hexaene |
|---|---|
| PubChem CID | 72567686 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 2-methyltetradeca-2,4,6,8,10,12-hexaene |
| SMILES | CC=CC=CC=CC=CC=CC=C(C)C |
| InChI | InChI=1S/C15H20/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3/h4-14H,1-3H3 |
| InChIKey | KMDOTTWHBTUYRV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|