C25H44S4 — CID 159683667
(4E,6E,8E,10E,12E,14E,16Z)-2,5,6,9,10,13,14-heptamethyloctadeca-2,4,6,8,10,12,14,16-octaene;sulfane (PubChem CID 159683667) has the molecular formula C25H44S4 and a molecular weight of 472.90 g/mol. Its IUPAC name is (4E,6E,8E,10E,12E,14E,16Z)-2,5,6,9,10,13,14-heptamethyloctadeca-2,4,6,8,10,12,14,16-octaene;sulfane.
| Compound Name | (4E,6E,8E,10E,12E,14E,16Z)-2,5,6,9,10,13,14-heptamethyloctadeca-2,4,6,8,10,12,14,16-octaene;sulfane |
|---|---|
| PubChem CID | 159683667 |
| Molecular Formula | C25H44S4 |
| Molecular Weight | 472.90 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | (4E,6E,8E,10E,12E,14E,16Z)-2,5,6,9,10,13,14-heptamethyloctadeca-2,4,6,8,10,12,14,16-octaene;sulfane |
| SMILES | C/C=C\C=C(C)\C(C)=C\C=C(C)\C(C)=C\C=C(C)\C(C)=C\C=C(C)C.S.S.S.S |
| InChI | InChI=1S/C25H36.4H2S/c1-10-11-12-20(4)22(6)15-16-24(8)25(9)18-17-23(7)21(5)14-13-19(2)3;;;;/h10-18H,1-9H3;4*1H2/b11-10-,20-12+,21-14+,22-15+,23-17+,24-16+,25-18+;;;; |
| InChIKey | MVNCOERXYMSFOU-QYHSPJGNSA-N |
| XLogP | 8.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.90 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|