C9H13Br — CID 90964929
5-bromo-2-methylocta-2,4,6-triene (PubChem CID 90964929) has the molecular formula C9H13Br and a molecular weight of 201.11 g/mol. Its IUPAC name is 5-bromo-2-methylocta-2,4,6-triene.
| Compound Name | 5-bromo-2-methylocta-2,4,6-triene |
|---|---|
| PubChem CID | 90964929 |
| Molecular Formula | C9H13Br |
| Molecular Weight | 201.11 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | 5-bromo-2-methylocta-2,4,6-triene |
| SMILES | CC=CC(Br)=CC=C(C)C |
| InChI | InChI=1S/C9H13Br/c1-4-5-9(10)7-6-8(2)3/h4-7H,1-3H3 |
| InChIKey | BLKSXFGOBJGPTE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.11 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|