C5H7Br — CID 89363869
(3Z)-2-bromopenta-1,3-diene (PubChem CID 89363869) has the molecular formula C5H7Br and a molecular weight of 147.01 g/mol. Its IUPAC name is (3Z)-2-bromopenta-1,3-diene.
| Compound Name | (3Z)-2-bromopenta-1,3-diene |
|---|---|
| PubChem CID | 89363869 |
| Molecular Formula | C5H7Br |
| Molecular Weight | 147.01 g/mol |
| Exact Mass | 145.97 |
| IUPAC Name | (3Z)-2-bromopenta-1,3-diene |
| SMILES | C=C(Br)/C=C\C |
| InChI | InChI=1S/C5H7Br/c1-3-4-5(2)6/h3-4H,2H2,1H3/b4-3- |
| InChIKey | GLRCRDAAMUODFR-ARJAWSKDSA-N |
| XLogP | 2.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.01 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|