About (3Z)-2-bromopenta-1,3-diene
(3Z)-2-bromopenta-1,3-diene (PubChem CID 89363869) has the molecular formula C5H7Br
and a molecular weight of 147.01 g/mol. Its IUPAC name is (3Z)-2-bromopenta-1,3-diene.
Molecular Properties
| Compound Name | (3Z)-2-bromopenta-1,3-diene |
| PubChem CID | 89363869 |
| Molecular Formula | C5H7Br |
| Molecular Weight | 147.01 g/mol |
| Exact Mass | 145.97 |
| IUPAC Name | (3Z)-2-bromopenta-1,3-diene |
| SMILES | C=C(Br)/C=C\C |
| InChI | InChI=1S/C5H7Br/c1-3-4-5(2)6/h3-4H,2H2,1H3/b4-3- |
| InChIKey | GLRCRDAAMUODFR-ARJAWSKDSA-N |
| XLogP | 2.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.01 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-2-bromopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-2-bromopenta-1,3-diene?
The IUPAC name of (3Z)-2-bromopenta-1,3-diene (CID 89363869) is (3Z)-2-bromopenta-1,3-diene.
What is the SMILES notation for (3Z)-2-bromopenta-1,3-diene?
The canonical SMILES for (3Z)-2-bromopenta-1,3-diene is C=C(Br)/C=C\C.
What is the InChIKey of (3Z)-2-bromopenta-1,3-diene?
The InChIKey is GLRCRDAAMUODFR-ARJAWSKDSA-N. The full InChI is InChI=1S/C5H7Br/c1-3-4-5(2)6/h3-4H,2H2,1H3/b4-3-.
What are the key properties of (3Z)-2-bromopenta-1,3-diene?
(3Z)-2-bromopenta-1,3-diene has a molecular weight of 147.01 g/mol, XLogP of 2.47, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-2-bromopenta-1,3-diene is sourced from PubChem (CID 89363869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).