C8H11Br — CID 144800259
(3E,5Z)-4-bromo-3-methylhepta-1,3,5-triene (PubChem CID 144800259) has the molecular formula C8H11Br and a molecular weight of 187.08 g/mol. Its IUPAC name is (3E,5Z)-4-bromo-3-methylhepta-1,3,5-triene.
| Compound Name | (3E,5Z)-4-bromo-3-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 144800259 |
| Molecular Formula | C8H11Br |
| Molecular Weight | 187.08 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | (3E,5Z)-4-bromo-3-methylhepta-1,3,5-triene |
| SMILES | C=C/C(C)=C(Br)\C=C/C |
| InChI | InChI=1S/C8H11Br/c1-4-6-8(9)7(3)5-2/h4-6H,2H2,1,3H3/b6-4-,8-7+ |
| InChIKey | HNFIDODSRUSDOS-IQTBQJLQSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.08 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|