C17H32 — CID 143006430
ethane;methane;(3E,5Z)-3-methyl-4-[(Z)-prop-1-enyl]octa-1,3,5,7-tetraene (PubChem CID 143006430) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is ethane;methane;(3E,5Z)-3-methyl-4-[(Z)-prop-1-enyl]octa-1,3,5,7-tetraene.
| Compound Name | ethane;methane;(3E,5Z)-3-methyl-4-[(Z)-prop-1-enyl]octa-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 143006430 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | ethane;methane;(3E,5Z)-3-methyl-4-[(Z)-prop-1-enyl]octa-1,3,5,7-tetraene |
| SMILES | C.C=C/C=C\C(\C=C/C)=C(/C)C=C.CC.CC |
| InChI | InChI=1S/C12H16.2C2H6.CH4/c1-5-8-10-12(9-6-2)11(4)7-3;2*1-2;/h5-10H,1,3H2,2,4H3;2*1-2H3;1H4/b9-6-,10-8-,12-11+;;; |
| InChIKey | JPWSYCVELSRQNQ-DXUYDJDQSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|