C13H24 — CID 162531355
ethane;3-ethenyl-4-methylhexa-1,3,5-triene (PubChem CID 162531355) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is ethane;3-ethenyl-4-methylhexa-1,3,5-triene.
| Compound Name | ethane;3-ethenyl-4-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 162531355 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | ethane;3-ethenyl-4-methylhexa-1,3,5-triene |
| SMILES | C=CC(C)=C(C=C)C=C.CC.CC |
| InChI | InChI=1S/C9H12.2C2H6/c1-5-8(4)9(6-2)7-3;2*1-2/h5-7H,1-3H2,4H3;2*1-2H3 |
| InChIKey | QQUUPSUVUPECPT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|