About ethane;3-ethenyl-4-methylhexa-1,3,5-triene
ethane;3-ethenyl-4-methylhexa-1,3,5-triene (PubChem CID 162531355) has the molecular formula C13H24
and a molecular weight of 180.33 g/mol. Its IUPAC name is ethane;3-ethenyl-4-methylhexa-1,3,5-triene.
Molecular Properties
| Compound Name | ethane;3-ethenyl-4-methylhexa-1,3,5-triene |
| PubChem CID | 162531355 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | ethane;3-ethenyl-4-methylhexa-1,3,5-triene |
| SMILES | C=CC(C)=C(C=C)C=C.CC.CC |
| InChI | InChI=1S/C9H12.2C2H6/c1-5-8(4)9(6-2)7-3;2*1-2/h5-7H,1-3H2,4H3;2*1-2H3 |
| InChIKey | QQUUPSUVUPECPT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-ethenyl-4-methylhexa-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethenyl-4-methylhexa-1,3,5-triene?
The IUPAC name of ethane;3-ethenyl-4-methylhexa-1,3,5-triene (CID 162531355) is ethane;3-ethenyl-4-methylhexa-1,3,5-triene.
What is the SMILES notation for ethane;3-ethenyl-4-methylhexa-1,3,5-triene?
The canonical SMILES for ethane;3-ethenyl-4-methylhexa-1,3,5-triene is C=CC(C)=C(C=C)C=C.CC.CC.
What is the InChIKey of ethane;3-ethenyl-4-methylhexa-1,3,5-triene?
The InChIKey is QQUUPSUVUPECPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.2C2H6/c1-5-8(4)9(6-2)7-3;2*1-2/h5-7H,1-3H2,4H3;2*1-2H3.
What are the key properties of ethane;3-ethenyl-4-methylhexa-1,3,5-triene?
ethane;3-ethenyl-4-methylhexa-1,3,5-triene has a molecular weight of 180.33 g/mol, XLogP of 4.91, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethenyl-4-methylhexa-1,3,5-triene is sourced from PubChem (CID 162531355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).