C6H11N — CID 141358440
3-methylpenta-2,4-dien-2-amine (PubChem CID 141358440) has the molecular formula C6H11N and a molecular weight of 97.16 g/mol. Its IUPAC name is 3-methylpenta-2,4-dien-2-amine.
| Compound Name | 3-methylpenta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 141358440 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | 3-methylpenta-2,4-dien-2-amine |
| SMILES | C=CC(C)=C(C)N |
| InChI | InChI=1S/C6H11N/c1-4-5(2)6(3)7/h4H,1,7H2,2-3H3 |
| InChIKey | MUOITGCPXLLKIC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|