C9H20N2 — CID 142059909
ethane;ethene;(2Z)-penta-2,4-diene-2,3-diamine (PubChem CID 142059909) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is ethane;ethene;(2Z)-penta-2,4-diene-2,3-diamine.
| Compound Name | ethane;ethene;(2Z)-penta-2,4-diene-2,3-diamine |
|---|---|
| PubChem CID | 142059909 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | ethane;ethene;(2Z)-penta-2,4-diene-2,3-diamine |
| SMILES | C=C.C=C/C(N)=C(\C)N.CC |
| InChI | InChI=1S/C5H10N2.C2H6.C2H4/c1-3-5(7)4(2)6;2*1-2/h3H,1,6-7H2,2H3;1-2H3;1-2H2/b5-4-;; |
| InChIKey | PPFDMSAGJKEKMP-WNCVTPEDSA-N |
| XLogP | 2.15 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|