C8H14BrN — CID 143722331
(3Z)-4-bromohexa-1,3,5-trien-3-amine;ethane (PubChem CID 143722331) has the molecular formula C8H14BrN and a molecular weight of 204.11 g/mol. Its IUPAC name is (3Z)-4-bromohexa-1,3,5-trien-3-amine;ethane.
| Compound Name | (3Z)-4-bromohexa-1,3,5-trien-3-amine;ethane |
|---|---|
| PubChem CID | 143722331 |
| Molecular Formula | C8H14BrN |
| Molecular Weight | 204.11 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | (3Z)-4-bromohexa-1,3,5-trien-3-amine;ethane |
| SMILES | C=C/C(N)=C(/Br)C=C.CC |
| InChI | InChI=1S/C6H8BrN.C2H6/c1-3-5(7)6(8)4-2;1-2/h3-4H,1-2,8H2;1-2H3/b6-5-; |
| InChIKey | WSSNWWGWDRSUPD-YSMBQZINSA-N |
| XLogP | 2.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.11 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|