C6H7BrClNO — CID 89180508
(3E,5Z)-6-amino-5-bromo-6-chlorohexa-1,3,5-trien-3-ol (PubChem CID 89180508) has the molecular formula C6H7BrClNO and a molecular weight of 224.48 g/mol. Its IUPAC name is (3E,5Z)-6-amino-5-bromo-6-chlorohexa-1,3,5-trien-3-ol.
| Compound Name | (3E,5Z)-6-amino-5-bromo-6-chlorohexa-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 89180508 |
| Molecular Formula | C6H7BrClNO |
| Molecular Weight | 224.48 g/mol |
| Exact Mass | 222.94 |
| IUPAC Name | (3E,5Z)-6-amino-5-bromo-6-chlorohexa-1,3,5-trien-3-ol |
| SMILES | C=C/C(O)=C\C(Br)=C(/N)Cl |
| InChI | InChI=1S/C6H7BrClNO/c1-2-4(10)3-5(7)6(8)9/h2-3,10H,1,9H2/b4-3+,6-5+ |
| InChIKey | CXWCQVAVRKUWTR-VNKDHWASSA-N |
| XLogP | 2.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|